C13H20ClNO3 — CID 81413769
3-(5-chloro-2,4-dimethoxyanilino)-2,2-dimethylpropan-1-ol (PubChem CID 81413769) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is 3-(5-chloro-2,4-dimethoxyanilino)-2,2-dimethylpropan-1-ol.
| Compound Name | 3-(5-chloro-2,4-dimethoxyanilino)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 81413769 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 3-(5-chloro-2,4-dimethoxyanilino)-2,2-dimethylpropan-1-ol |
| SMILES | COc1cc(OC)c(NCC(C)(C)CO)cc1Cl |
| InChI | InChI=1S/C13H20ClNO3/c1-13(2,8-16)7-15-10-5-9(14)11(17-3)6-12(10)18-4/h5-6,15-16H,7-8H2,1-4H3 |
| InChIKey | ARSCVCWFWSRORP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|