C12H18ClNO2 — CID 80504258
3-(3-chloro-4-methoxyanilino)-2,2-dimethylpropan-1-ol (PubChem CID 80504258) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyanilino)-2,2-dimethylpropan-1-ol.
| Compound Name | 3-(3-chloro-4-methoxyanilino)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 80504258 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-(3-chloro-4-methoxyanilino)-2,2-dimethylpropan-1-ol |
| SMILES | COc1ccc(NCC(C)(C)CO)cc1Cl |
| InChI | InChI=1S/C12H18ClNO2/c1-12(2,8-15)7-14-9-4-5-11(16-3)10(13)6-9/h4-6,14-15H,7-8H2,1-3H3 |
| InChIKey | QOPYNJPHXMRHQC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|