C13H20ClNO2 — CID 115135194
3-(3-chloro-4-methoxy-N-methylanilino)-2,2-dimethylpropan-1-ol (PubChem CID 115135194) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxy-N-methylanilino)-2,2-dimethylpropan-1-ol.
| Compound Name | 3-(3-chloro-4-methoxy-N-methylanilino)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 115135194 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-(3-chloro-4-methoxy-N-methylanilino)-2,2-dimethylpropan-1-ol |
| SMILES | COc1ccc(N(C)CC(C)(C)CO)cc1Cl |
| InChI | InChI=1S/C13H20ClNO2/c1-13(2,9-16)8-15(3)10-5-6-12(17-4)11(14)7-10/h5-7,16H,8-9H2,1-4H3 |
| InChIKey | CNVIVABFPIHTCZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|