C14H22ClNO — CID 114270442
3-chloro-4-methoxy-N-(2,3,3-trimethylbutyl)aniline (PubChem CID 114270442) has the molecular formula C14H22ClNO and a molecular weight of 255.79 g/mol. Its IUPAC name is 3-chloro-4-methoxy-N-(2,3,3-trimethylbutyl)aniline.
| Compound Name | 3-chloro-4-methoxy-N-(2,3,3-trimethylbutyl)aniline |
|---|---|
| PubChem CID | 114270442 |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-chloro-4-methoxy-N-(2,3,3-trimethylbutyl)aniline |
| SMILES | COc1ccc(NCC(C)C(C)(C)C)cc1Cl |
| InChI | InChI=1S/C14H22ClNO/c1-10(14(2,3)4)9-16-11-6-7-13(17-5)12(15)8-11/h6-8,10,16H,9H2,1-5H3 |
| InChIKey | FIVGJXZHRSBVAV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|