C16H23ClN2O3 — CID 108958078
N-(3-chloro-4-methoxyphenyl)-2,2-dimethyl-N'-(2-methylpropyl)propanediamide (PubChem CID 108958078) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2,2-dimethyl-N'-(2-methylpropyl)propanediamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2,2-dimethyl-N'-(2-methylpropyl)propanediamide |
|---|---|
| PubChem CID | 108958078 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2,2-dimethyl-N'-(2-methylpropyl)propanediamide |
| SMILES | COc1ccc(NC(=O)C(C)(C)C(=O)NCC(C)C)cc1Cl |
| InChI | InChI=1S/C16H23ClN2O3/c1-10(2)9-18-14(20)16(3,4)15(21)19-11-6-7-13(22-5)12(17)8-11/h6-8,10H,9H2,1-5H3,(H,18,20)(H,19,21) |
| InChIKey | RBJOPTCIGPRWMG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|