C20H23ClN2O4 — CID 108969247
N-(3-chloro-4-methoxyphenyl)-N'-(2-ethoxyphenyl)-2,2-dimethylpropanediamide (PubChem CID 108969247) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-N'-(2-ethoxyphenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-N'-(2-ethoxyphenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108969247 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-N'-(2-ethoxyphenyl)-2,2-dimethylpropanediamide |
| SMILES | CCOc1ccccc1NC(=O)C(C)(C)C(=O)Nc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C20H23ClN2O4/c1-5-27-17-9-7-6-8-15(17)23-19(25)20(2,3)18(24)22-13-10-11-16(26-4)14(21)12-13/h6-12H,5H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | ADEAZKXLDRUGDN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|