C20H21F3N2O3 — CID 108969461
N-(2-ethoxyphenyl)-2,2-dimethyl-N'-[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 108969461) has the molecular formula C20H21F3N2O3 and a molecular weight of 394.39 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2,2-dimethyl-N'-[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N-(2-ethoxyphenyl)-2,2-dimethyl-N'-[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 108969461 |
| Molecular Formula | C20H21F3N2O3 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-(2-ethoxyphenyl)-2,2-dimethyl-N'-[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | CCOc1ccccc1NC(=O)C(C)(C)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H21F3N2O3/c1-4-28-16-11-6-5-10-15(16)25-18(27)19(2,3)17(26)24-14-9-7-8-13(12-14)20(21,22)23/h5-12H,4H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | RUCYJFIMFKRXNO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|