C22H30ClNO2 — CID 54855580
3-chloro-N-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentyl]-4-methoxyaniline (PubChem CID 54855580) has the molecular formula C22H30ClNO2 and a molecular weight of 375.94 g/mol. Its IUPAC name is 3-chloro-N-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentyl]-4-methoxyaniline.
| Compound Name | 3-chloro-N-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 54855580 |
| Molecular Formula | C22H30ClNO2 |
| Molecular Weight | 375.94 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 3-chloro-N-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentyl]-4-methoxyaniline |
| SMILES | COc1ccc(NCC(C)(C)CCCOc2cc(C)ccc2C)cc1Cl |
| InChI | InChI=1S/C22H30ClNO2/c1-16-7-8-17(2)21(13-16)26-12-6-11-22(3,4)15-24-18-9-10-20(25-5)19(23)14-18/h7-10,13-14,24H,6,11-12,15H2,1-5H3 |
| InChIKey | ZTTQXTYTFMACSQ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.94 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|