C22H30ClNO — CID 54855583
N-[(2-chlorophenyl)methyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentan-1-amine (PubChem CID 54855583) has the molecular formula C22H30ClNO and a molecular weight of 359.94 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentan-1-amine.
| Compound Name | N-[(2-chlorophenyl)methyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 54855583 |
| Molecular Formula | C22H30ClNO |
| Molecular Weight | 359.94 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentan-1-amine |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)CNCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C22H30ClNO/c1-17-10-11-18(2)21(14-17)25-13-7-12-22(3,4)16-24-15-19-8-5-6-9-20(19)23/h5-6,8-11,14,24H,7,12-13,15-16H2,1-4H3 |
| InChIKey | WVHJXMPDUKFLJF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.94 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|