C25H37NO2 — CID 54855693
4-butoxy-N-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentyl]aniline (PubChem CID 54855693) has the molecular formula C25H37NO2 and a molecular weight of 383.58 g/mol. Its IUPAC name is 4-butoxy-N-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentyl]aniline.
| Compound Name | 4-butoxy-N-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentyl]aniline |
|---|---|
| PubChem CID | 54855693 |
| Molecular Formula | C25H37NO2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | 4-butoxy-N-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentyl]aniline |
| SMILES | CCCCOc1ccc(NCC(C)(C)CCCOc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C25H37NO2/c1-6-7-16-27-23-13-11-22(12-14-23)26-19-25(4,5)15-8-17-28-24-18-20(2)9-10-21(24)3/h9-14,18,26H,6-8,15-17,19H2,1-5H3 |
| InChIKey | LTQPJTCHZNUNOA-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|