C27H37ClN2O2 — CID 142458019
N-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide (PubChem CID 142458019) has the molecular formula C27H37ClN2O2 and a molecular weight of 457.06 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide.
| Compound Name | N-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 142458019 |
| Molecular Formula | C27H37ClN2O2 |
| Molecular Weight | 457.06 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | N-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NC2CCN(Cc3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C27H37ClN2O2/c1-20-10-11-21(2)25(18-20)32-17-7-14-27(3,4)26(31)29-23-12-15-30(16-13-23)19-22-8-5-6-9-24(22)28/h5-6,8-11,18,23H,7,12-17,19H2,1-4H3,(H,29,31) |
| InChIKey | UDOADBIISOONPC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.06 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|