C26H31Cl2N3O2 — CID 142457621
N-[1-[(2-cyanophenyl)methyl]piperidin-4-yl]-5-(2,5-dichlorophenoxy)-2,2-dimethylpentanamide (PubChem CID 142457621) has the molecular formula C26H31Cl2N3O2 and a molecular weight of 488.46 g/mol. Its IUPAC name is N-[1-[(2-cyanophenyl)methyl]piperidin-4-yl]-5-(2,5-dichlorophenoxy)-2,2-dimethylpentanamide.
| Compound Name | N-[1-[(2-cyanophenyl)methyl]piperidin-4-yl]-5-(2,5-dichlorophenoxy)-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 142457621 |
| Molecular Formula | C26H31Cl2N3O2 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | N-[1-[(2-cyanophenyl)methyl]piperidin-4-yl]-5-(2,5-dichlorophenoxy)-2,2-dimethylpentanamide |
| SMILES | CC(C)(CCCOc1cc(Cl)ccc1Cl)C(=O)NC1CCN(Cc2ccccc2C#N)CC1 |
| InChI | InChI=1S/C26H31Cl2N3O2/c1-26(2,12-5-15-33-24-16-21(27)8-9-23(24)28)25(32)30-22-10-13-31(14-11-22)18-20-7-4-3-6-19(20)17-29/h3-4,6-9,16,22H,5,10-15,18H2,1-2H3,(H,30,32) |
| InChIKey | SZJTWCRMHNCSKX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|