C26H33N3O2 — CID 142457969
N-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-2,2-dimethyl-5-phenoxypentanamide (PubChem CID 142457969) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-2,2-dimethyl-5-phenoxypentanamide.
| Compound Name | N-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-2,2-dimethyl-5-phenoxypentanamide |
|---|---|
| PubChem CID | 142457969 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | N-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-2,2-dimethyl-5-phenoxypentanamide |
| SMILES | CC(C)(CCCOc1ccccc1)C(=O)NC1CCN(Cc2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C26H33N3O2/c1-26(2,14-7-17-31-24-10-4-3-5-11-24)25(30)28-23-12-15-29(16-13-23)20-22-9-6-8-21(18-22)19-27/h3-6,8-11,18,23H,7,12-17,20H2,1-2H3,(H,28,30) |
| InChIKey | MBRSXWCJYQFOMR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|