C25H31N3O3 — CID 55745478
4-(4-cyano-2-methoxyphenoxy)-N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]butanamide (PubChem CID 55745478) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-(4-cyano-2-methoxyphenoxy)-N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]butanamide.
| Compound Name | 4-(4-cyano-2-methoxyphenoxy)-N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 55745478 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 4-(4-cyano-2-methoxyphenoxy)-N-[1-[(3-methylphenyl)methyl]piperidin-4-yl]butanamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)NC1CCN(Cc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C25H31N3O3/c1-19-5-3-6-21(15-19)18-28-12-10-22(11-13-28)27-25(29)7-4-14-31-23-9-8-20(17-26)16-24(23)30-2/h3,5-6,8-9,15-16,22H,4,7,10-14,18H2,1-2H3,(H,27,29) |
| InChIKey | LPHDKIFUQNJMGX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|