C22H26N4O4 — CID 56502865
4-(4-cyano-2-methoxyphenoxy)-N'-[2-(2,4-dimethylanilino)acetyl]butanehydrazide (PubChem CID 56502865) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-(4-cyano-2-methoxyphenoxy)-N'-[2-(2,4-dimethylanilino)acetyl]butanehydrazide.
| Compound Name | 4-(4-cyano-2-methoxyphenoxy)-N'-[2-(2,4-dimethylanilino)acetyl]butanehydrazide |
|---|---|
| PubChem CID | 56502865 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 4-(4-cyano-2-methoxyphenoxy)-N'-[2-(2,4-dimethylanilino)acetyl]butanehydrazide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)NNC(=O)CNc1ccc(C)cc1C |
| InChI | InChI=1S/C22H26N4O4/c1-15-6-8-18(16(2)11-15)24-14-22(28)26-25-21(27)5-4-10-30-19-9-7-17(13-23)12-20(19)29-3/h6-9,11-12,24H,4-5,10,14H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | UCSHKTVIFGTTKZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|