C15H16N4O3 — CID 47835221
4-(4-cyano-2-methoxyphenoxy)-N-(1H-pyrazol-5-yl)butanamide (PubChem CID 47835221) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 4-(4-cyano-2-methoxyphenoxy)-N-(1H-pyrazol-5-yl)butanamide.
| Compound Name | 4-(4-cyano-2-methoxyphenoxy)-N-(1H-pyrazol-5-yl)butanamide |
|---|---|
| PubChem CID | 47835221 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 4-(4-cyano-2-methoxyphenoxy)-N-(1H-pyrazol-5-yl)butanamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C15H16N4O3/c1-21-13-9-11(10-16)4-5-12(13)22-8-2-3-15(20)18-14-6-7-17-19-14/h4-7,9H,2-3,8H2,1H3,(H2,17,18,19,20) |
| InChIKey | VXHBMVUZJRHDFP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|