C20H18ClN3O5 — CID 55760950
N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-4-(4-cyano-2-methoxyphenoxy)butanamide (PubChem CID 55760950) has the molecular formula C20H18ClN3O5 and a molecular weight of 415.83 g/mol. Its IUPAC name is N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-4-(4-cyano-2-methoxyphenoxy)butanamide.
| Compound Name | N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-4-(4-cyano-2-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 55760950 |
| Molecular Formula | C20H18ClN3O5 |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-4-(4-cyano-2-methoxyphenoxy)butanamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)Nc1cc2c(cc1Cl)NC(=O)CO2 |
| InChI | InChI=1S/C20H18ClN3O5/c1-27-18-7-12(10-22)4-5-16(18)28-6-2-3-19(25)23-14-9-17-15(8-13(14)21)24-20(26)11-29-17/h4-5,7-9H,2-3,6,11H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | GGIQXVWOXNDJHO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|