C20H29N3O3 — CID 55713088
4-(4-cyano-2-methoxyphenoxy)-N-[[1-(dimethylamino)cyclopentyl]methyl]butanamide (PubChem CID 55713088) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-(4-cyano-2-methoxyphenoxy)-N-[[1-(dimethylamino)cyclopentyl]methyl]butanamide.
| Compound Name | 4-(4-cyano-2-methoxyphenoxy)-N-[[1-(dimethylamino)cyclopentyl]methyl]butanamide |
|---|---|
| PubChem CID | 55713088 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 4-(4-cyano-2-methoxyphenoxy)-N-[[1-(dimethylamino)cyclopentyl]methyl]butanamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)NCC1(N(C)C)CCCC1 |
| InChI | InChI=1S/C20H29N3O3/c1-23(2)20(10-4-5-11-20)15-22-19(24)7-6-12-26-17-9-8-16(14-21)13-18(17)25-3/h8-9,13H,4-7,10-12,15H2,1-3H3,(H,22,24) |
| InChIKey | AUKRAGFWFIBULW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|