C19H18F2N2O4 — CID 55742192
4-(4-cyano-2-methoxyphenoxy)-N-[3-(difluoromethoxy)phenyl]butanamide (PubChem CID 55742192) has the molecular formula C19H18F2N2O4 and a molecular weight of 376.36 g/mol. Its IUPAC name is 4-(4-cyano-2-methoxyphenoxy)-N-[3-(difluoromethoxy)phenyl]butanamide.
| Compound Name | 4-(4-cyano-2-methoxyphenoxy)-N-[3-(difluoromethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 55742192 |
| Molecular Formula | C19H18F2N2O4 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 4-(4-cyano-2-methoxyphenoxy)-N-[3-(difluoromethoxy)phenyl]butanamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)Nc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C19H18F2N2O4/c1-25-17-10-13(12-22)7-8-16(17)26-9-3-6-18(24)23-14-4-2-5-15(11-14)27-19(20)21/h2,4-5,7-8,10-11,19H,3,6,9H2,1H3,(H,23,24) |
| InChIKey | OJLHLJVZUCHFGO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|