C19H17F3N2O4 — CID 55712515
4-(4-cyano-2-methoxyphenoxy)-N-[3-(trifluoromethoxy)phenyl]butanamide (PubChem CID 55712515) has the molecular formula C19H17F3N2O4 and a molecular weight of 394.35 g/mol. Its IUPAC name is 4-(4-cyano-2-methoxyphenoxy)-N-[3-(trifluoromethoxy)phenyl]butanamide.
| Compound Name | 4-(4-cyano-2-methoxyphenoxy)-N-[3-(trifluoromethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 55712515 |
| Molecular Formula | C19H17F3N2O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 4-(4-cyano-2-methoxyphenoxy)-N-[3-(trifluoromethoxy)phenyl]butanamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F3N2O4/c1-26-17-10-13(12-23)7-8-16(17)27-9-3-6-18(25)24-14-4-2-5-15(11-14)28-19(20,21)22/h2,4-5,7-8,10-11H,3,6,9H2,1H3,(H,24,25) |
| InChIKey | QJTDVHQVECZGQY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|