C22H25N3O4 — CID 55719091
4-(4-cyano-2-methoxyphenoxy)-N-[3-(2-methylpropanoylamino)phenyl]butanamide (PubChem CID 55719091) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-(4-cyano-2-methoxyphenoxy)-N-[3-(2-methylpropanoylamino)phenyl]butanamide.
| Compound Name | 4-(4-cyano-2-methoxyphenoxy)-N-[3-(2-methylpropanoylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 55719091 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 4-(4-cyano-2-methoxyphenoxy)-N-[3-(2-methylpropanoylamino)phenyl]butanamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)Nc1cccc(NC(=O)C(C)C)c1 |
| InChI | InChI=1S/C22H25N3O4/c1-15(2)22(27)25-18-7-4-6-17(13-18)24-21(26)8-5-11-29-19-10-9-16(14-23)12-20(19)28-3/h4,6-7,9-10,12-13,15H,5,8,11H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | VMWPOWJVROQGGQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|