C22H24F2N2O4 — CID 46485327
4-(4-cyano-2-methoxyphenoxy)-N-[1-[2-(difluoromethoxy)phenyl]propyl]butanamide (PubChem CID 46485327) has the molecular formula C22H24F2N2O4 and a molecular weight of 418.44 g/mol. Its IUPAC name is 4-(4-cyano-2-methoxyphenoxy)-N-[1-[2-(difluoromethoxy)phenyl]propyl]butanamide.
| Compound Name | 4-(4-cyano-2-methoxyphenoxy)-N-[1-[2-(difluoromethoxy)phenyl]propyl]butanamide |
|---|---|
| PubChem CID | 46485327 |
| Molecular Formula | C22H24F2N2O4 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 4-(4-cyano-2-methoxyphenoxy)-N-[1-[2-(difluoromethoxy)phenyl]propyl]butanamide |
| SMILES | CCC(NC(=O)CCCOc1ccc(C#N)cc1OC)c1ccccc1OC(F)F |
| InChI | InChI=1S/C22H24F2N2O4/c1-3-17(16-7-4-5-8-18(16)30-22(23)24)26-21(27)9-6-12-29-19-11-10-15(14-25)13-20(19)28-2/h4-5,7-8,10-11,13,17,22H,3,6,9,12H2,1-2H3,(H,26,27) |
| InChIKey | MZPWWMIUWMDIFY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|