C13H16ClN3O4 — CID 79272383
N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-2-(2-methoxyethylamino)acetamide (PubChem CID 79272383) has the molecular formula C13H16ClN3O4 and a molecular weight of 313.74 g/mol. Its IUPAC name is N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-2-(2-methoxyethylamino)acetamide.
| Compound Name | N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-2-(2-methoxyethylamino)acetamide |
|---|---|
| PubChem CID | 79272383 |
| Molecular Formula | C13H16ClN3O4 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-2-(2-methoxyethylamino)acetamide |
| SMILES | COCCNCC(=O)Nc1cc2c(cc1Cl)NC(=O)CO2 |
| InChI | InChI=1S/C13H16ClN3O4/c1-20-3-2-15-6-12(18)16-9-5-11-10(4-8(9)14)17-13(19)7-21-11/h4-5,15H,2-3,6-7H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | UEYLBGUTPPHRCD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|