C17H22ClN3O3 — CID 119722257
N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-3-piperidin-4-ylbutanamide (PubChem CID 119722257) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-3-piperidin-4-ylbutanamide.
| Compound Name | N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-3-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 119722257 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-3-piperidin-4-ylbutanamide |
| SMILES | CC(CC(=O)Nc1cc2c(cc1Cl)NC(=O)CO2)C1CCNCC1 |
| InChI | InChI=1S/C17H22ClN3O3/c1-10(11-2-4-19-5-3-11)6-16(22)20-13-8-15-14(7-12(13)18)21-17(23)9-24-15/h7-8,10-11,19H,2-6,9H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | IBAVJDQNVOQSOW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |