C11H10BrClN2O3 — CID 107903711
2-bromo-N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)propanamide (PubChem CID 107903711) has the molecular formula C11H10BrClN2O3 and a molecular weight of 333.57 g/mol. Its IUPAC name is 2-bromo-N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)propanamide.
| Compound Name | 2-bromo-N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)propanamide |
|---|---|
| PubChem CID | 107903711 |
| Molecular Formula | C11H10BrClN2O3 |
| Molecular Weight | 333.57 g/mol |
| Exact Mass | 331.96 |
| IUPAC Name | 2-bromo-N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)propanamide |
| SMILES | CC(Br)C(=O)Nc1cc2c(cc1Cl)NC(=O)CO2 |
| InChI | InChI=1S/C11H10BrClN2O3/c1-5(12)11(17)15-7-3-9-8(2-6(7)13)14-10(16)4-18-9/h2-3,5H,4H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | BISNKRILHIWXNH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|