C12H9ClN2O5 — CID 60941243
(E)-4-[(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)amino]-4-oxobut-2-enoic acid (PubChem CID 60941243) has the molecular formula C12H9ClN2O5 and a molecular weight of 296.67 g/mol. Its IUPAC name is (E)-4-[(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 60941243 |
| Molecular Formula | C12H9ClN2O5 |
| Molecular Weight | 296.67 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | (E)-4-[(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1cc2c(cc1Cl)NC(=O)CO2 |
| InChI | InChI=1S/C12H9ClN2O5/c13-6-3-8-9(20-5-11(17)15-8)4-7(6)14-10(16)1-2-12(18)19/h1-4H,5H2,(H,14,16)(H,15,17)(H,18,19)/b2-1+ |
| InChIKey | CXSYHLBCRTWUMX-OWOJBTEDSA-N |
| XLogP | 1.25 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.67 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|