C13H16ClN3O3 — CID 43705148
2-amino-N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-3-methylbutanamide (PubChem CID 43705148) has the molecular formula C13H16ClN3O3 and a molecular weight of 297.74 g/mol. Its IUPAC name is 2-amino-N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-3-methylbutanamide.
| Compound Name | 2-amino-N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 43705148 |
| Molecular Formula | C13H16ClN3O3 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-amino-N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-3-methylbutanamide |
| SMILES | CC(C)C(N)C(=O)Nc1cc2c(cc1Cl)NC(=O)CO2 |
| InChI | InChI=1S/C13H16ClN3O3/c1-6(2)12(15)13(19)17-8-4-10-9(3-7(8)14)16-11(18)5-20-10/h3-4,6,12H,5,15H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | KEHXKANRCPTFGL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |