C21H20N4O4 — CID 55765783
4-(4-cyano-2-methoxyphenoxy)-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]butanamide (PubChem CID 55765783) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is 4-(4-cyano-2-methoxyphenoxy)-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]butanamide.
| Compound Name | 4-(4-cyano-2-methoxyphenoxy)-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 55765783 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 4-(4-cyano-2-methoxyphenoxy)-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]butanamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)Nc1ccccc1-c1noc(C)n1 |
| InChI | InChI=1S/C21H20N4O4/c1-14-23-21(25-29-14)16-6-3-4-7-17(16)24-20(26)8-5-11-28-18-10-9-15(13-22)12-19(18)27-2/h3-4,6-7,9-10,12H,5,8,11H2,1-2H3,(H,24,26) |
| InChIKey | FEGUHGVDNDYKAD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|