C26H33N3O5S — CID 142457747
N-[1-(4-cyanophenyl)sulfonylpiperidin-4-yl]-5-(4-methoxyphenoxy)-2,2-dimethylpentanamide (PubChem CID 142457747) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)sulfonylpiperidin-4-yl]-5-(4-methoxyphenoxy)-2,2-dimethylpentanamide.
| Compound Name | N-[1-(4-cyanophenyl)sulfonylpiperidin-4-yl]-5-(4-methoxyphenoxy)-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 142457747 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | N-[1-(4-cyanophenyl)sulfonylpiperidin-4-yl]-5-(4-methoxyphenoxy)-2,2-dimethylpentanamide |
| SMILES | COc1ccc(OCCCC(C)(C)C(=O)NC2CCN(S(=O)(=O)c3ccc(C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H33N3O5S/c1-26(2,15-4-18-34-23-9-7-22(33-3)8-10-23)25(30)28-21-13-16-29(17-14-21)35(31,32)24-11-5-20(19-27)6-12-24/h5-12,21H,4,13-18H2,1-3H3,(H,28,30) |
| InChIKey | ZAVCMHFSJDXBSM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|