C25H31F3N2O5S — CID 175467290
1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-2,2-dimethyl-5-[4-(trifluoromethyl)phenoxy]pentan-1-one (PubChem CID 175467290) has the molecular formula C25H31F3N2O5S and a molecular weight of 528.59 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-2,2-dimethyl-5-[4-(trifluoromethyl)phenoxy]pentan-1-one.
| Compound Name | 1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-2,2-dimethyl-5-[4-(trifluoromethyl)phenoxy]pentan-1-one |
|---|---|
| PubChem CID | 175467290 |
| Molecular Formula | C25H31F3N2O5S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-2,2-dimethyl-5-[4-(trifluoromethyl)phenoxy]pentan-1-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)C(C)(C)CCCOc3ccc(C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H31F3N2O5S/c1-24(2,13-4-18-35-21-7-5-19(6-8-21)25(26,27)28)23(31)29-14-16-30(17-15-29)36(32,33)22-11-9-20(34-3)10-12-22/h5-12H,4,13-18H2,1-3H3 |
| InChIKey | JTGPNJBJXMSWEW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|