C25H29F3N2O6S — CID 175467248
3-[4-[2,2-dimethyl-5-[4-(trifluoromethyl)phenoxy]pentanoyl]piperazin-1-yl]sulfonylbenzoic acid (PubChem CID 175467248) has the molecular formula C25H29F3N2O6S and a molecular weight of 542.58 g/mol. Its IUPAC name is 3-[4-[2,2-dimethyl-5-[4-(trifluoromethyl)phenoxy]pentanoyl]piperazin-1-yl]sulfonylbenzoic acid.
| Compound Name | 3-[4-[2,2-dimethyl-5-[4-(trifluoromethyl)phenoxy]pentanoyl]piperazin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 175467248 |
| Molecular Formula | C25H29F3N2O6S |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 3-[4-[2,2-dimethyl-5-[4-(trifluoromethyl)phenoxy]pentanoyl]piperazin-1-yl]sulfonylbenzoic acid |
| SMILES | CC(C)(CCCOc1ccc(C(F)(F)F)cc1)C(=O)N1CCN(S(=O)(=O)c2cccc(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C25H29F3N2O6S/c1-24(2,11-4-16-36-20-9-7-19(8-10-20)25(26,27)28)23(33)29-12-14-30(15-13-29)37(34,35)21-6-3-5-18(17-21)22(31)32/h3,5-10,17H,4,11-16H2,1-2H3,(H,31,32) |
| InChIKey | SKXOGNJSGHJNCI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|