C24H28F2N2O6S — CID 175467261
1-[4-(1,3-benzodioxol-5-ylsulfonyl)piperazin-1-yl]-5-(3,4-difluorophenoxy)-2,2-dimethylpentan-1-one (PubChem CID 175467261) has the molecular formula C24H28F2N2O6S and a molecular weight of 510.56 g/mol. Its IUPAC name is 1-[4-(1,3-benzodioxol-5-ylsulfonyl)piperazin-1-yl]-5-(3,4-difluorophenoxy)-2,2-dimethylpentan-1-one.
| Compound Name | 1-[4-(1,3-benzodioxol-5-ylsulfonyl)piperazin-1-yl]-5-(3,4-difluorophenoxy)-2,2-dimethylpentan-1-one |
|---|---|
| PubChem CID | 175467261 |
| Molecular Formula | C24H28F2N2O6S |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 1-[4-(1,3-benzodioxol-5-ylsulfonyl)piperazin-1-yl]-5-(3,4-difluorophenoxy)-2,2-dimethylpentan-1-one |
| SMILES | CC(C)(CCCOc1ccc(F)c(F)c1)C(=O)N1CCN(S(=O)(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C24H28F2N2O6S/c1-24(2,8-3-13-32-17-4-6-19(25)20(26)14-17)23(29)27-9-11-28(12-10-27)35(30,31)18-5-7-21-22(15-18)34-16-33-21/h4-7,14-15H,3,8-13,16H2,1-2H3 |
| InChIKey | LJNKINHVJNOSMG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|