C26H36N2O6S2 — CID 175467291
5-(2,5-dimethylphenoxy)-2,2-dimethyl-1-[4-(4-methylsulfonylphenyl)sulfonylpiperazin-1-yl]pentan-1-one (PubChem CID 175467291) has the molecular formula C26H36N2O6S2 and a molecular weight of 536.72 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-1-[4-(4-methylsulfonylphenyl)sulfonylpiperazin-1-yl]pentan-1-one.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-1-[4-(4-methylsulfonylphenyl)sulfonylpiperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 175467291 |
| Molecular Formula | C26H36N2O6S2 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-1-[4-(4-methylsulfonylphenyl)sulfonylpiperazin-1-yl]pentan-1-one |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)N2CCN(S(=O)(=O)c3ccc(S(C)(=O)=O)cc3)CC2)c1 |
| InChI | InChI=1S/C26H36N2O6S2/c1-20-7-8-21(2)24(19-20)34-18-6-13-26(3,4)25(29)27-14-16-28(17-15-27)36(32,33)23-11-9-22(10-12-23)35(5,30)31/h7-12,19H,6,13-18H2,1-5H3 |
| InChIKey | WWZZTRJNZJIFCL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|