C26H36N2O5S — CID 175467251
5-(2,5-dimethylphenoxy)-1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-2,2-dimethylpentan-1-one (PubChem CID 175467251) has the molecular formula C26H36N2O5S and a molecular weight of 488.65 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-2,2-dimethylpentan-1-one.
| Compound Name | 5-(2,5-dimethylphenoxy)-1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-2,2-dimethylpentan-1-one |
|---|---|
| PubChem CID | 175467251 |
| Molecular Formula | C26H36N2O5S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-2,2-dimethylpentan-1-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)C(C)(C)CCCOc3cc(C)ccc3C)CC2)cc1 |
| InChI | InChI=1S/C26H36N2O5S/c1-20-7-8-21(2)24(19-20)33-18-6-13-26(3,4)25(29)27-14-16-28(17-15-27)34(30,31)23-11-9-22(32-5)10-12-23/h7-12,19H,6,13-18H2,1-5H3 |
| InChIKey | WXLWGKPMTGIQRB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|