C24H28ClFN2O6S — CID 175467208
4-[4-[5-(2-chloro-4-fluorophenoxy)-2,2-dimethylpentanoyl]piperazin-1-yl]sulfonylbenzoic acid (PubChem CID 175467208) has the molecular formula C24H28ClFN2O6S and a molecular weight of 527.01 g/mol. Its IUPAC name is 4-[4-[5-(2-chloro-4-fluorophenoxy)-2,2-dimethylpentanoyl]piperazin-1-yl]sulfonylbenzoic acid.
| Compound Name | 4-[4-[5-(2-chloro-4-fluorophenoxy)-2,2-dimethylpentanoyl]piperazin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 175467208 |
| Molecular Formula | C24H28ClFN2O6S |
| Molecular Weight | 527.01 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 4-[4-[5-(2-chloro-4-fluorophenoxy)-2,2-dimethylpentanoyl]piperazin-1-yl]sulfonylbenzoic acid |
| SMILES | CC(C)(CCCOc1ccc(F)cc1Cl)C(=O)N1CCN(S(=O)(=O)c2ccc(C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C24H28ClFN2O6S/c1-24(2,10-3-15-34-21-9-6-18(26)16-20(21)25)23(31)27-11-13-28(14-12-27)35(32,33)19-7-4-17(5-8-19)22(29)30/h4-9,16H,3,10-15H2,1-2H3,(H,29,30) |
| InChIKey | RIABUIGYJYZXBU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.01 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|