C25H30F2N2O5S — CID 175467183
5-(3,4-difluorophenoxy)-1-[4-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)piperazin-1-yl]-2,2-dimethylpentan-1-one (PubChem CID 175467183) has the molecular formula C25H30F2N2O5S and a molecular weight of 508.59 g/mol. Its IUPAC name is 5-(3,4-difluorophenoxy)-1-[4-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)piperazin-1-yl]-2,2-dimethylpentan-1-one.
| Compound Name | 5-(3,4-difluorophenoxy)-1-[4-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)piperazin-1-yl]-2,2-dimethylpentan-1-one |
|---|---|
| PubChem CID | 175467183 |
| Molecular Formula | C25H30F2N2O5S |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 5-(3,4-difluorophenoxy)-1-[4-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)piperazin-1-yl]-2,2-dimethylpentan-1-one |
| SMILES | CC(C)(CCCOc1ccc(F)c(F)c1)C(=O)N1CCN(S(=O)(=O)c2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C25H30F2N2O5S/c1-25(2,9-3-14-33-19-4-6-21(26)22(27)17-19)24(30)28-10-12-29(13-11-28)35(31,32)20-5-7-23-18(16-20)8-15-34-23/h4-7,16-17H,3,8-15H2,1-2H3 |
| InChIKey | QWXDQJPVXINYCM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|