C25H30F2N2O6S — CID 142457500
4-[4-[[5-(2,4-difluorophenoxy)-2,2-dimethylpentanoyl]amino]piperidin-1-yl]sulfonylbenzoic acid (PubChem CID 142457500) has the molecular formula C25H30F2N2O6S and a molecular weight of 524.59 g/mol. Its IUPAC name is 4-[4-[[5-(2,4-difluorophenoxy)-2,2-dimethylpentanoyl]amino]piperidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 4-[4-[[5-(2,4-difluorophenoxy)-2,2-dimethylpentanoyl]amino]piperidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 142457500 |
| Molecular Formula | C25H30F2N2O6S |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 4-[4-[[5-(2,4-difluorophenoxy)-2,2-dimethylpentanoyl]amino]piperidin-1-yl]sulfonylbenzoic acid |
| SMILES | CC(C)(CCCOc1ccc(F)cc1F)C(=O)NC1CCN(S(=O)(=O)c2ccc(C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C25H30F2N2O6S/c1-25(2,12-3-15-35-22-9-6-18(26)16-21(22)27)24(32)28-19-10-13-29(14-11-19)36(33,34)20-7-4-17(5-8-20)23(30)31/h4-9,16,19H,3,10-15H2,1-2H3,(H,28,32)(H,30,31) |
| InChIKey | AUEHENYXHNZWAC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|