C28H33N3O6S — CID 142457760
4-[4-[(2,2-dimethyl-5-quinolin-6-yloxypentanoyl)amino]piperidin-1-yl]sulfonylbenzoic acid (PubChem CID 142457760) has the molecular formula C28H33N3O6S and a molecular weight of 539.65 g/mol. Its IUPAC name is 4-[4-[(2,2-dimethyl-5-quinolin-6-yloxypentanoyl)amino]piperidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 4-[4-[(2,2-dimethyl-5-quinolin-6-yloxypentanoyl)amino]piperidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 142457760 |
| Molecular Formula | C28H33N3O6S |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 4-[4-[(2,2-dimethyl-5-quinolin-6-yloxypentanoyl)amino]piperidin-1-yl]sulfonylbenzoic acid |
| SMILES | CC(C)(CCCOc1ccc2ncccc2c1)C(=O)NC1CCN(S(=O)(=O)c2ccc(C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C28H33N3O6S/c1-28(2,14-4-18-37-23-8-11-25-21(19-23)5-3-15-29-25)27(34)30-22-12-16-31(17-13-22)38(35,36)24-9-6-20(7-10-24)26(32)33/h3,5-11,15,19,22H,4,12-14,16-18H2,1-2H3,(H,30,34)(H,32,33) |
| InChIKey | KZLRTRSBFZPXGT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|