C23H29F2N3O4S — CID 142457751
5-(3,4-difluorophenoxy)-2,2-dimethyl-N-(1-pyridin-3-ylsulfonylpiperidin-4-yl)pentanamide (PubChem CID 142457751) has the molecular formula C23H29F2N3O4S and a molecular weight of 481.57 g/mol. Its IUPAC name is 5-(3,4-difluorophenoxy)-2,2-dimethyl-N-(1-pyridin-3-ylsulfonylpiperidin-4-yl)pentanamide.
| Compound Name | 5-(3,4-difluorophenoxy)-2,2-dimethyl-N-(1-pyridin-3-ylsulfonylpiperidin-4-yl)pentanamide |
|---|---|
| PubChem CID | 142457751 |
| Molecular Formula | C23H29F2N3O4S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 5-(3,4-difluorophenoxy)-2,2-dimethyl-N-(1-pyridin-3-ylsulfonylpiperidin-4-yl)pentanamide |
| SMILES | CC(C)(CCCOc1ccc(F)c(F)c1)C(=O)NC1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C23H29F2N3O4S/c1-23(2,10-4-14-32-18-6-7-20(24)21(25)15-18)22(29)27-17-8-12-28(13-9-17)33(30,31)19-5-3-11-26-16-19/h3,5-7,11,15-17H,4,8-10,12-14H2,1-2H3,(H,27,29) |
| InChIKey | DUIKKCZPFLLNOH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|