C25H29Cl2N3O4S — CID 142458060
N-[1-(3-cyanophenyl)sulfonylpiperidin-4-yl]-5-(2,5-dichlorophenoxy)-2,2-dimethylpentanamide (PubChem CID 142458060) has the molecular formula C25H29Cl2N3O4S and a molecular weight of 538.50 g/mol. Its IUPAC name is N-[1-(3-cyanophenyl)sulfonylpiperidin-4-yl]-5-(2,5-dichlorophenoxy)-2,2-dimethylpentanamide.
| Compound Name | N-[1-(3-cyanophenyl)sulfonylpiperidin-4-yl]-5-(2,5-dichlorophenoxy)-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 142458060 |
| Molecular Formula | C25H29Cl2N3O4S |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | N-[1-(3-cyanophenyl)sulfonylpiperidin-4-yl]-5-(2,5-dichlorophenoxy)-2,2-dimethylpentanamide |
| SMILES | CC(C)(CCCOc1cc(Cl)ccc1Cl)C(=O)NC1CCN(S(=O)(=O)c2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C25H29Cl2N3O4S/c1-25(2,11-4-14-34-23-16-19(26)7-8-22(23)27)24(31)29-20-9-12-30(13-10-20)35(32,33)21-6-3-5-18(15-21)17-28/h3,5-8,15-16,20H,4,9-14H2,1-2H3,(H,29,31) |
| InChIKey | FCMVYRWHDLRYFP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|