C18H25Cl2FN2O2 — CID 142457530
5-(2,5-dichlorophenoxy)-N-[(3R,4R)-3-fluoropiperidin-4-yl]-2,2-dimethylpentanamide (PubChem CID 142457530) has the molecular formula C18H25Cl2FN2O2 and a molecular weight of 391.31 g/mol. Its IUPAC name is 5-(2,5-dichlorophenoxy)-N-[(3R,4R)-3-fluoropiperidin-4-yl]-2,2-dimethylpentanamide.
| Compound Name | 5-(2,5-dichlorophenoxy)-N-[(3R,4R)-3-fluoropiperidin-4-yl]-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 142457530 |
| Molecular Formula | C18H25Cl2FN2O2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 5-(2,5-dichlorophenoxy)-N-[(3R,4R)-3-fluoropiperidin-4-yl]-2,2-dimethylpentanamide |
| SMILES | CC(C)(CCCOc1cc(Cl)ccc1Cl)C(=O)N[C@@H]1CCNC[C@H]1F |
| InChI | InChI=1S/C18H25Cl2FN2O2/c1-18(2,17(24)23-15-6-8-22-11-14(15)21)7-3-9-25-16-10-12(19)4-5-13(16)20/h4-5,10,14-15,22H,3,6-9,11H2,1-2H3,(H,23,24)/t14-,15-/m1/s1 |
| InChIKey | BGGFOCUCQPCHJX-HUUCEWRRSA-N |
| XLogP | 3.99 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|