C13H19Cl2NO — CID 65255805
5-(2,5-dichlorophenoxy)-2,2-dimethylpentan-1-amine (PubChem CID 65255805) has the molecular formula C13H19Cl2NO and a molecular weight of 276.21 g/mol. Its IUPAC name is 5-(2,5-dichlorophenoxy)-2,2-dimethylpentan-1-amine.
| Compound Name | 5-(2,5-dichlorophenoxy)-2,2-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 65255805 |
| Molecular Formula | C13H19Cl2NO |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 5-(2,5-dichlorophenoxy)-2,2-dimethylpentan-1-amine |
| SMILES | CC(C)(CN)CCCOc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H19Cl2NO/c1-13(2,9-16)6-3-7-17-12-8-10(14)4-5-11(12)15/h4-5,8H,3,6-7,9,16H2,1-2H3 |
| InChIKey | RSSFUENYLVJXNX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|