C16H17Cl2NO3 — CID 22682500
[3-[2-(2,5-dichlorophenoxy)ethoxy]-4-methoxyphenyl]methanamine (PubChem CID 22682500) has the molecular formula C16H17Cl2NO3 and a molecular weight of 342.22 g/mol. Its IUPAC name is [3-[2-(2,5-dichlorophenoxy)ethoxy]-4-methoxyphenyl]methanamine.
| Compound Name | [3-[2-(2,5-dichlorophenoxy)ethoxy]-4-methoxyphenyl]methanamine |
|---|---|
| PubChem CID | 22682500 |
| Molecular Formula | C16H17Cl2NO3 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | [3-[2-(2,5-dichlorophenoxy)ethoxy]-4-methoxyphenyl]methanamine |
| SMILES | COc1ccc(CN)cc1OCCOc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H17Cl2NO3/c1-20-14-5-2-11(10-19)8-16(14)22-7-6-21-15-9-12(17)3-4-13(15)18/h2-5,8-9H,6-7,10,19H2,1H3 |
| InChIKey | BLVILPCLAYSTPK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|