C19H19Cl2N3O3S — CID 112797113
4-[4-[2-(2,5-dichlorophenoxy)ethyl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 112797113) has the molecular formula C19H19Cl2N3O3S and a molecular weight of 440.35 g/mol. Its IUPAC name is 4-[4-[2-(2,5-dichlorophenoxy)ethyl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 4-[4-[2-(2,5-dichlorophenoxy)ethyl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 112797113 |
| Molecular Formula | C19H19Cl2N3O3S |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 4-[4-[2-(2,5-dichlorophenoxy)ethyl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCN(CCOc3cc(Cl)ccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C19H19Cl2N3O3S/c20-16-3-6-18(21)19(13-16)27-12-11-23-7-9-24(10-8-23)28(25,26)17-4-1-15(14-22)2-5-17/h1-6,13H,7-12H2 |
| InChIKey | MVRKFGFNRPHXSC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |