C16H22Cl2N2O3S — CID 126799490
1-cyclopropylsulfonyl-4-[2-(2,5-dichlorophenoxy)ethyl]-1,4-diazepane (PubChem CID 126799490) has the molecular formula C16H22Cl2N2O3S and a molecular weight of 393.34 g/mol. Its IUPAC name is 1-cyclopropylsulfonyl-4-[2-(2,5-dichlorophenoxy)ethyl]-1,4-diazepane.
| Compound Name | 1-cyclopropylsulfonyl-4-[2-(2,5-dichlorophenoxy)ethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 126799490 |
| Molecular Formula | C16H22Cl2N2O3S |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 1-cyclopropylsulfonyl-4-[2-(2,5-dichlorophenoxy)ethyl]-1,4-diazepane |
| SMILES | O=S(=O)(C1CC1)N1CCCN(CCOc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C16H22Cl2N2O3S/c17-13-2-5-15(18)16(12-13)23-11-10-19-6-1-7-20(9-8-19)24(21,22)14-3-4-14/h2,5,12,14H,1,3-4,6-11H2 |
| InChIKey | FVEQTGRTWVZZMG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |