C20H24Cl2N2O — CID 112808904
1-[2-(2,5-dichlorophenoxy)ethyl]-4-(2-phenylethyl)piperazine (PubChem CID 112808904) has the molecular formula C20H24Cl2N2O and a molecular weight of 379.33 g/mol. Its IUPAC name is 1-[2-(2,5-dichlorophenoxy)ethyl]-4-(2-phenylethyl)piperazine.
| Compound Name | 1-[2-(2,5-dichlorophenoxy)ethyl]-4-(2-phenylethyl)piperazine |
|---|---|
| PubChem CID | 112808904 |
| Molecular Formula | C20H24Cl2N2O |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 1-[2-(2,5-dichlorophenoxy)ethyl]-4-(2-phenylethyl)piperazine |
| SMILES | Clc1ccc(Cl)c(OCCN2CCN(CCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H24Cl2N2O/c21-18-6-7-19(22)20(16-18)25-15-14-24-12-10-23(11-13-24)9-8-17-4-2-1-3-5-17/h1-7,16H,8-15H2 |
| InChIKey | JIDNWWLRUOFZLR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |