C17H23Cl2NO3 — CID 124730726
methyl 2-[(4S)-1-[2-(2,5-dichlorophenoxy)ethyl]azepan-4-yl]acetate (PubChem CID 124730726) has the molecular formula C17H23Cl2NO3 and a molecular weight of 360.28 g/mol. Its IUPAC name is methyl 2-[(4S)-1-[2-(2,5-dichlorophenoxy)ethyl]azepan-4-yl]acetate.
| Compound Name | methyl 2-[(4S)-1-[2-(2,5-dichlorophenoxy)ethyl]azepan-4-yl]acetate |
|---|---|
| PubChem CID | 124730726 |
| Molecular Formula | C17H23Cl2NO3 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | methyl 2-[(4S)-1-[2-(2,5-dichlorophenoxy)ethyl]azepan-4-yl]acetate |
| SMILES | COC(=O)C[C@H]1CCCN(CCOc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H23Cl2NO3/c1-22-17(21)11-13-3-2-7-20(8-6-13)9-10-23-16-12-14(18)4-5-15(16)19/h4-5,12-13H,2-3,6-11H2,1H3/t13-/m0/s1 |
| InChIKey | HVWOCVBNTUGTGK-ZDUSSCGKSA-N |
| XLogP | 4.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |