About N-butyl-1-[2-(2,5-dichlorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide
N-butyl-1-[2-(2,5-dichlorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide (PubChem CID 112840866) has the molecular formula C19H28Cl2N2O2
and a molecular weight of 387.35 g/mol. Its IUPAC name is N-butyl-1-[2-(2,5-dichlorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-butyl-1-[2-(2,5-dichlorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide |
| PubChem CID | 112840866 |
| Molecular Formula | C19H28Cl2N2O2 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-butyl-1-[2-(2,5-dichlorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CCN(CCOc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C19H28Cl2N2O2/c1-3-4-9-22(2)19(24)15-7-10-23(11-8-15)12-13-25-18-14-16(20)5-6-17(18)21/h5-6,14-15H,3-4,7-13H2,1-2H3 |
| InChIKey | BUHPRSTWFAMHTM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butyl-1-[2-(2,5-dichlorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-1-[2-(2,5-dichlorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide?
The IUPAC name of N-butyl-1-[2-(2,5-dichlorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide (CID 112840866) is N-butyl-1-[2-(2,5-dichlorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide.
What is the SMILES notation for N-butyl-1-[2-(2,5-dichlorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide?
The canonical SMILES for N-butyl-1-[2-(2,5-dichlorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide is CCCCN(C)C(=O)C1CCN(CCOc2cc(Cl)ccc2Cl)CC1.
What is the InChIKey of N-butyl-1-[2-(2,5-dichlorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide?
The InChIKey is BUHPRSTWFAMHTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28Cl2N2O2/c1-3-4-9-22(2)19(24)15-7-10-23(11-8-15)12-13-25-18-14-16(20)5-6-17(18)21/h5-6,14-15H,3-4,7-13H2,1-2H3.
What are the key properties of N-butyl-1-[2-(2,5-dichlorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide?
N-butyl-1-[2-(2,5-dichlorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide has a molecular weight of 387.35 g/mol, XLogP of 4.34, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-1-[2-(2,5-dichlorophenoxy)ethyl]-N-methylpiperidine-4-carboxamide is sourced from PubChem (CID 112840866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).