C19H27ClN2O2 — CID 109149934
4-N-butyl-1-N-(4-chlorophenyl)-4-N-methylcyclohexane-1,4-dicarboxamide (PubChem CID 109149934) has the molecular formula C19H27ClN2O2 and a molecular weight of 350.89 g/mol. Its IUPAC name is 4-N-butyl-1-N-(4-chlorophenyl)-4-N-methylcyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-butyl-1-N-(4-chlorophenyl)-4-N-methylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109149934 |
| Molecular Formula | C19H27ClN2O2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 4-N-butyl-1-N-(4-chlorophenyl)-4-N-methylcyclohexane-1,4-dicarboxamide |
| SMILES | CCCCN(C)C(=O)C1CCC(C(=O)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H27ClN2O2/c1-3-4-13-22(2)19(24)15-7-5-14(6-8-15)18(23)21-17-11-9-16(20)10-12-17/h9-12,14-15H,3-8,13H2,1-2H3,(H,21,23) |
| InChIKey | CUWSLNYCPCPNAW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |