C17H26ClNO4 — CID 120953603
2-[1-[2-(2-methoxyphenoxy)ethyl]azepan-4-yl]acetic acid;hydrochloride (PubChem CID 120953603) has the molecular formula C17H26ClNO4 and a molecular weight of 343.85 g/mol. Its IUPAC name is 2-[1-[2-(2-methoxyphenoxy)ethyl]azepan-4-yl]acetic acid;hydrochloride.
| Compound Name | 2-[1-[2-(2-methoxyphenoxy)ethyl]azepan-4-yl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 120953603 |
| Molecular Formula | C17H26ClNO4 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-[1-[2-(2-methoxyphenoxy)ethyl]azepan-4-yl]acetic acid;hydrochloride |
| SMILES | COc1ccccc1OCCN1CCCC(CC(=O)O)CC1.Cl |
| InChI | InChI=1S/C17H25NO4.ClH/c1-21-15-6-2-3-7-16(15)22-12-11-18-9-4-5-14(8-10-18)13-17(19)20;/h2-3,6-7,14H,4-5,8-13H2,1H3,(H,19,20);1H |
| InChIKey | FDWWOWGIJCROEW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |